C26H44O2Si — CID 11611415
(2E,4E,6E,8E)-9-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraen-1-ol (PubChem CID 11611415) has the molecular formula C26H44O2Si and a molecular weight of 416.72 g/mol. Its IUPAC name is (2E,4E,6E,8E)-9-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraen-1-ol.
| Compound Name | (2E,4E,6E,8E)-9-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraen-1-ol |
|---|---|
| PubChem CID | 11611415 |
| Molecular Formula | C26H44O2Si |
| Molecular Weight | 416.72 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | (2E,4E,6E,8E)-9-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylcyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraen-1-ol |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/CO)C(C)(C)C[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C26H44O2Si/c1-20(12-11-13-21(2)16-17-27)14-15-24-22(3)18-23(19-26(24,7)8)28-29(9,10)25(4,5)6/h11-16,23,27H,17-19H2,1-10H3/b13-11+,15-14+,20-12+,21-16+/t23-/m1/s1 |
| InChIKey | BYRGLQBPUCIMQL-BENCPEETSA-N |
| XLogP | 7.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.72 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|