C26H28N4O4 — CID 11612323
(1R,2S,13R,14S)-5,20-dihydroxy-7,19-dimethoxy-6,18,22-trimethyl-9,12,22-triazahexacyclo[12.7.1.14,8.02,12.016,21.011,23]tricosa-4(23),5,7,10,16(21),17,19-heptaene-13-carbonitrile (PubChem CID 11612323) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is (1R,2S,13R,14S)-5,20-dihydroxy-7,19-dimethoxy-6,18,22-trimethyl-9,12,22-triazahexacyclo[12.7.1.14,8.02,12.016,21.011,23]tricosa-4(23),5,7,10,16(21),17,19-heptaene-13-carbonitrile.
| Compound Name | (1R,2S,13R,14S)-5,20-dihydroxy-7,19-dimethoxy-6,18,22-trimethyl-9,12,22-triazahexacyclo[12.7.1.14,8.02,12.016,21.011,23]tricosa-4(23),5,7,10,16(21),17,19-heptaene-13-carbonitrile |
|---|---|
| PubChem CID | 11612323 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (1R,2S,13R,14S)-5,20-dihydroxy-7,19-dimethoxy-6,18,22-trimethyl-9,12,22-triazahexacyclo[12.7.1.14,8.02,12.016,21.011,23]tricosa-4(23),5,7,10,16(21),17,19-heptaene-13-carbonitrile |
| SMILES | COc1c(C)cc2c(c1O)[C@@H]1[C@@H]3Cc4c(O)c(C)c(OC)c5[nH]cc(c45)N3[C@@H](C#N)[C@H](C2)N1C |
| InChI | InChI=1S/C26H28N4O4/c1-11-6-13-7-15-17(9-27)30-16(22(29(15)3)19(13)24(32)25(11)33-4)8-14-20-18(30)10-28-21(20)26(34-5)12(2)23(14)31/h6,10,15-17,22,28,31-32H,7-8H2,1-5H3/t15-,16-,17-,22-/m0/s1 |
| InChIKey | CHUFAPNMRQBHKH-DOWNOZBLSA-N |
| XLogP | 3.45 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|