About (2-fluorophenyl)-(2,4,6-trimethylphenyl)methanimine
(2-fluorophenyl)-(2,4,6-trimethylphenyl)methanimine (PubChem CID 11615657) has the molecular formula C16H16FN
and a molecular weight of 241.31 g/mol. Its IUPAC name is (2-fluorophenyl)-(2,4,6-trimethylphenyl)methanimine.
Molecular Properties
| Compound Name | (2-fluorophenyl)-(2,4,6-trimethylphenyl)methanimine |
| PubChem CID | 11615657 |
| Molecular Formula | C16H16FN |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (2-fluorophenyl)-(2,4,6-trimethylphenyl)methanimine |
| SMILES | [H]/N=C(\c1ccccc1F)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H16FN/c1-10-8-11(2)15(12(3)9-10)16(18)13-6-4-5-7-14(13)17/h4-9,18H,1-3H3/b18-16+ |
| InChIKey | GALJMNXOTVIMIF-FBMGVBCBSA-N |
| XLogP | 4.17 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2-fluorophenyl)-(2,4,6-trimethylphenyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl)-(2,4,6-trimethylphenyl)methanimine?
The IUPAC name of (2-fluorophenyl)-(2,4,6-trimethylphenyl)methanimine (CID 11615657) is (2-fluorophenyl)-(2,4,6-trimethylphenyl)methanimine.
What is the SMILES notation for (2-fluorophenyl)-(2,4,6-trimethylphenyl)methanimine?
The canonical SMILES for (2-fluorophenyl)-(2,4,6-trimethylphenyl)methanimine is [H]/N=C(\c1ccccc1F)c1c(C)cc(C)cc1C.
What is the InChIKey of (2-fluorophenyl)-(2,4,6-trimethylphenyl)methanimine?
The InChIKey is GALJMNXOTVIMIF-FBMGVBCBSA-N. The full InChI is InChI=1S/C16H16FN/c1-10-8-11(2)15(12(3)9-10)16(18)13-6-4-5-7-14(13)17/h4-9,18H,1-3H3/b18-16+.
What are the key properties of (2-fluorophenyl)-(2,4,6-trimethylphenyl)methanimine?
(2-fluorophenyl)-(2,4,6-trimethylphenyl)methanimine has a molecular weight of 241.31 g/mol, XLogP of 4.17, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl)-(2,4,6-trimethylphenyl)methanimine is sourced from PubChem (CID 11615657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).