C14H11F2N — CID 140970160
1,2-bis(2-fluorophenyl)ethanimine (PubChem CID 140970160) has the molecular formula C14H11F2N and a molecular weight of 231.25 g/mol. Its IUPAC name is 1,2-bis(2-fluorophenyl)ethanimine.
| Compound Name | 1,2-bis(2-fluorophenyl)ethanimine |
|---|---|
| PubChem CID | 140970160 |
| Molecular Formula | C14H11F2N |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 1,2-bis(2-fluorophenyl)ethanimine |
| SMILES | [H]/N=C(/Cc1ccccc1F)c1ccccc1F |
| InChI | InChI=1S/C14H11F2N/c15-12-7-3-1-5-10(12)9-14(17)11-6-2-4-8-13(11)16/h1-8,17H,9H2/b17-14- |
| InChIKey | CJPYLYDUWMSHHI-VKAVYKQESA-N |
| XLogP | 3.58 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|