C16H22N2O4S — CID 11617014
2-butyl-4-(2-methoxyethylamino)-1,1-dioxo-5-phenyl-1,2-thiazol-3-one (PubChem CID 11617014) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-butyl-4-(2-methoxyethylamino)-1,1-dioxo-5-phenyl-1,2-thiazol-3-one.
| Compound Name | 2-butyl-4-(2-methoxyethylamino)-1,1-dioxo-5-phenyl-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 11617014 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-butyl-4-(2-methoxyethylamino)-1,1-dioxo-5-phenyl-1,2-thiazol-3-one |
| SMILES | CCCCN1C(=O)C(NCCOC)=C(c2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C16H22N2O4S/c1-3-4-11-18-16(19)14(17-10-12-22-2)15(23(18,20)21)13-8-6-5-7-9-13/h5-9,17H,3-4,10-12H2,1-2H3 |
| InChIKey | FSZNZIVSWQRHPH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|