C20H23FN4O — CID 11617335
(2-fluoro-4-pyrimidin-5-ylphenyl)-[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 11617335) has the molecular formula C20H23FN4O and a molecular weight of 354.43 g/mol. Its IUPAC name is (2-fluoro-4-pyrimidin-5-ylphenyl)-[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (2-fluoro-4-pyrimidin-5-ylphenyl)-[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 11617335 |
| Molecular Formula | C20H23FN4O |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (2-fluoro-4-pyrimidin-5-ylphenyl)-[2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(-c2cncnc2)cc1F)N1CCCC1CN1CCCC1 |
| InChI | InChI=1S/C20H23FN4O/c21-19-10-15(16-11-22-14-23-12-16)5-6-18(19)20(26)25-9-3-4-17(25)13-24-7-1-2-8-24/h5-6,10-12,14,17H,1-4,7-9,13H2 |
| InChIKey | JRDHVNBHNKIBQP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |