C23H25F6NO — CID 11619202
4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylazocane (PubChem CID 11619202) has the molecular formula C23H25F6NO and a molecular weight of 445.45 g/mol. Its IUPAC name is 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylazocane.
| Compound Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylazocane |
|---|---|
| PubChem CID | 11619202 |
| Molecular Formula | C23H25F6NO |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-4-phenylazocane |
| SMILES | FC(F)(F)c1cc(COCC2(c3ccccc3)CCCCNCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H25F6NO/c24-22(25,26)19-12-17(13-20(14-19)23(27,28)29)15-31-16-21(18-6-2-1-3-7-18)8-4-5-10-30-11-9-21/h1-3,6-7,12-14,30H,4-5,8-11,15-16H2 |
| InChIKey | SWRYEUIYPAAURZ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |