C47H32Cl4N4O2S — CID 11622037
(7'Z)-3',4',6'-tris(4-chlorophenyl)-7'-[(4-chlorophenyl)methylidene]-1,3-diphenyl-2-sulfanylidenespiro[1,3-diazinane-5,5'-3,3a,4,6-tetrahydro-2H-indazole]-4,6-dione (PubChem CID 11622037) has the molecular formula C47H32Cl4N4O2S and a molecular weight of 858.68 g/mol. Its IUPAC name is (7'Z)-3',4',6'-tris(4-chlorophenyl)-7'-[(4-chlorophenyl)methylidene]-1,3-diphenyl-2-sulfanylidenespiro[1,3-diazinane-5,5'-3,3a,4,6-tetrahydro-2H-indazole]-4,6-dione.
| Compound Name | (7'Z)-3',4',6'-tris(4-chlorophenyl)-7'-[(4-chlorophenyl)methylidene]-1,3-diphenyl-2-sulfanylidenespiro[1,3-diazinane-5,5'-3,3a,4,6-tetrahydro-2H-indazole]-4,6-dione |
|---|---|
| PubChem CID | 11622037 |
| Molecular Formula | C47H32Cl4N4O2S |
| Molecular Weight | 858.68 g/mol |
| Exact Mass | 856.10 |
| IUPAC Name | (7'Z)-3',4',6'-tris(4-chlorophenyl)-7'-[(4-chlorophenyl)methylidene]-1,3-diphenyl-2-sulfanylidenespiro[1,3-diazinane-5,5'-3,3a,4,6-tetrahydro-2H-indazole]-4,6-dione |
| SMILES | O=C1N(c2ccccc2)C(=S)N(c2ccccc2)C(=O)C12C(c1ccc(Cl)cc1)/C(=C/c1ccc(Cl)cc1)C1=NNC(c3ccc(Cl)cc3)C1C2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C47H32Cl4N4O2S/c48-32-19-11-28(12-20-32)27-38-40(29-13-21-33(49)22-14-29)47(44(56)54(36-7-3-1-4-8-36)46(58)55(45(47)57)37-9-5-2-6-10-37)41(30-15-23-34(50)24-16-30)39-42(52-53-43(38)39)31-17-25-35(51)26-18-31/h1-27,39-42,52H/b38-27- |
| InChIKey | ZCCOWJGDZMMAJB-SPKJYZRXSA-N |
| XLogP | 11.93 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.68 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|