About 4-azidophenol
4-azidophenol (PubChem CID 11622340) has the molecular formula C6H5N3O
and a molecular weight of 135.13 g/mol. Its IUPAC name is 4-azidophenol.
Molecular Properties
| Compound Name | 4-azidophenol |
| PubChem CID | 11622340 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 4-azidophenol |
| SMILES | [N-]=[N+]=Nc1ccc(O)cc1 |
| InChI | InChI=1S/C6H5N3O/c7-9-8-5-1-3-6(10)4-2-5/h1-4,10H |
| InChIKey | ABSZNIJDTSIVHN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azidophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azidophenol?
The IUPAC name of 4-azidophenol (CID 11622340) is 4-azidophenol.
What is the SMILES notation for 4-azidophenol?
The canonical SMILES for 4-azidophenol is [N-]=[N+]=Nc1ccc(O)cc1.
What is the InChIKey of 4-azidophenol?
The InChIKey is ABSZNIJDTSIVHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O/c7-9-8-5-1-3-6(10)4-2-5/h1-4,10H.
What are the key properties of 4-azidophenol?
4-azidophenol has a molecular weight of 135.13 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azidophenol is sourced from PubChem (CID 11622340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).