C11H16O3 — CID 11622498
(4R,5S)-4-cyclohexyl-5-ethenyl-1,3-dioxolan-2-one (PubChem CID 11622498) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (4R,5S)-4-cyclohexyl-5-ethenyl-1,3-dioxolan-2-one.
| Compound Name | (4R,5S)-4-cyclohexyl-5-ethenyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 11622498 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (4R,5S)-4-cyclohexyl-5-ethenyl-1,3-dioxolan-2-one |
| SMILES | C=C[C@@H]1OC(=O)O[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C11H16O3/c1-2-9-10(14-11(12)13-9)8-6-4-3-5-7-8/h2,8-10H,1,3-7H2/t9-,10+/m0/s1 |
| InChIKey | CJIYHTAOTPLZSX-VHSXEESVSA-N |
| XLogP | 2.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|