C12H18O3 — CID 11622585
(3aS,4S,7aR)-2,2-dimethyl-4-prop-1-en-2-yl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-one (PubChem CID 11622585) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (3aS,4S,7aR)-2,2-dimethyl-4-prop-1-en-2-yl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-one.
| Compound Name | (3aS,4S,7aR)-2,2-dimethyl-4-prop-1-en-2-yl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-one |
|---|---|
| PubChem CID | 11622585 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (3aS,4S,7aR)-2,2-dimethyl-4-prop-1-en-2-yl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-one |
| SMILES | C=C(C)[C@@H]1C(=O)CC[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C12H18O3/c1-7(2)10-8(13)5-6-9-11(10)15-12(3,4)14-9/h9-11H,1,5-6H2,2-4H3/t9-,10-,11-/m1/s1 |
| InChIKey | RMNOKKIAUFLTHQ-GMTAPVOTSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|