About Prolyl-proline
Prolyl-proline (PubChem CID 11622593) has the molecular formula C10H16N2O3
and a molecular weight of 212.25 g/mol. Its IUPAC name is (2S)-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | Prolyl-proline |
| PubChem CID | 11622593 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (2S)-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | C1C[C@H](NC1)C(=O)N2CCC[C@H]2C(=O)O |
| InChI | InChI=1S/C10H16N2O3/c13-9(7-3-1-5-11-7)12-6-2-4-8(12)10(14)15/h7-8,11H,1-6H2,(H,14,15)/t7-,8-/m0/s1 |
| InChIKey | RWCOTTLHDJWHRS-YUMQZZPRSA-N |
| XLogP | -2.30 |
| TPSA | 69.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | 280 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Prolyl-proline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Prolyl-proline?
The IUPAC name of Prolyl-proline (CID 11622593) is (2S)-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid.
What is the SMILES notation for Prolyl-proline?
The canonical SMILES for Prolyl-proline is C1C[C@H](NC1)C(=O)N2CCC[C@H]2C(=O)O.
What is the InChIKey of Prolyl-proline?
The InChIKey is RWCOTTLHDJWHRS-YUMQZZPRSA-N. The full InChI is InChI=1S/C10H16N2O3/c13-9(7-3-1-5-11-7)12-6-2-4-8(12)10(14)15/h7-8,11H,1-6H2,(H,14,15)/t7-,8-/m0/s1.
What are the key properties of Prolyl-proline?
Prolyl-proline has a molecular weight of 212.25 g/mol, XLogP of -2.30, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Prolyl-proline is sourced from PubChem (CID 11622593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).