About Pro-Hyp zwitterion
Pro-Hyp zwitterion (PubChem CID 11902892) has the molecular formula C10H16N2O4
and a molecular weight of 228.24 g/mol. Its IUPAC name is (2S,4R)-4-hydroxy-1-[(2S)-pyrrolidin-1-ium-2-carbonyl]pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | Pro-Hyp zwitterion |
| PubChem CID | 11902892 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (2S,4R)-4-hydroxy-1-[(2S)-pyrrolidin-1-ium-2-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | C1C[C@H]([NH2+]C1)C(=O)N2C[C@@H](C[C@H]2C(=O)[O-])O |
| InChI | InChI=1S/C10H16N2O4/c13-6-4-8(10(15)16)12(5-6)9(14)7-2-1-3-11-7/h6-8,11,13H,1-5H2,(H,15,16)/t6-,7+,8+/m1/s1 |
| InChIKey | ONPXCLZMBSJLSP-CSMHCCOUSA-N |
| XLogP | -2.60 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | 302 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Pro-Hyp zwitterion with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Pro-Hyp zwitterion?
The IUPAC name of Pro-Hyp zwitterion (CID 11902892) is (2S,4R)-4-hydroxy-1-[(2S)-pyrrolidin-1-ium-2-carbonyl]pyrrolidine-2-carboxylate.
What is the SMILES notation for Pro-Hyp zwitterion?
The canonical SMILES for Pro-Hyp zwitterion is C1C[C@H]([NH2+]C1)C(=O)N2C[C@@H](C[C@H]2C(=O)[O-])O.
What is the InChIKey of Pro-Hyp zwitterion?
The InChIKey is ONPXCLZMBSJLSP-CSMHCCOUSA-N. The full InChI is InChI=1S/C10H16N2O4/c13-6-4-8(10(15)16)12(5-6)9(14)7-2-1-3-11-7/h6-8,11,13H,1-5H2,(H,15,16)/t6-,7+,8+/m1/s1.
What are the key properties of Pro-Hyp zwitterion?
Pro-Hyp zwitterion has a molecular weight of 228.24 g/mol, XLogP of -2.60, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Pro-Hyp zwitterion is sourced from PubChem (CID 11902892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).