C24H22N2O2 — CID 11624890
3-nitro-N,N-bis[(E)-3-phenylprop-2-enyl]aniline (PubChem CID 11624890) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-nitro-N,N-bis[(E)-3-phenylprop-2-enyl]aniline.
| Compound Name | 3-nitro-N,N-bis[(E)-3-phenylprop-2-enyl]aniline |
|---|---|
| PubChem CID | 11624890 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 3-nitro-N,N-bis[(E)-3-phenylprop-2-enyl]aniline |
| SMILES | O=[N+]([O-])c1cccc(N(C/C=C/c2ccccc2)C/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C24H22N2O2/c27-26(28)24-17-7-16-23(20-24)25(18-8-14-21-10-3-1-4-11-21)19-9-15-22-12-5-2-6-13-22/h1-17,20H,18-19H2/b14-8+,15-9+ |
| InChIKey | SGSDHZXETFMDCJ-VOMDNODZSA-N |
| XLogP | 5.83 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|