C23H28N2O4 — CID 11625398
methyl (1S,12S,13R,14S,15E)-15-ethylidene-13-(hydroxymethyl)-5-methoxy-3-methyl-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4(9),5,7-tetraene-13-carboxylate (PubChem CID 11625398) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is methyl (1S,12S,13R,14S,15E)-15-ethylidene-13-(hydroxymethyl)-5-methoxy-3-methyl-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4(9),5,7-tetraene-13-carboxylate.
| Compound Name | methyl (1S,12S,13R,14S,15E)-15-ethylidene-13-(hydroxymethyl)-5-methoxy-3-methyl-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4(9),5,7-tetraene-13-carboxylate |
|---|---|
| PubChem CID | 11625398 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | methyl (1S,12S,13R,14S,15E)-15-ethylidene-13-(hydroxymethyl)-5-methoxy-3-methyl-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4(9),5,7-tetraene-13-carboxylate |
| SMILES | C/C=C1/CN2[C@H]3Cc4c(n(C)c5c(OC)cccc45)[C@@H]2C[C@@H]1[C@@]3(CO)C(=O)OC |
| InChI | InChI=1S/C23H28N2O4/c1-5-13-11-25-17-10-16(13)23(12-26,22(27)29-4)19(25)9-15-14-7-6-8-18(28-3)21(14)24(2)20(15)17/h5-8,16-17,19,26H,9-12H2,1-4H3/b13-5-/t16-,17-,19-,23+/m0/s1 |
| InChIKey | PMTUYBJOSCRXMK-OJKHAKENSA-N |
| XLogP | 2.59 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|