C24H31N2O3+ — CID 102357237
ethyl (1S,14R,15Z)-15-ethylidene-5-methoxy-3,17-dimethyl-3-aza-17-azoniapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4(9),5,7-tetraene-13-carboxylate (PubChem CID 102357237) has the molecular formula C24H31N2O3+ and a molecular weight of 395.52 g/mol. Its IUPAC name is ethyl (1S,14R,15Z)-15-ethylidene-5-methoxy-3,17-dimethyl-3-aza-17-azoniapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4(9),5,7-tetraene-13-carboxylate.
| Compound Name | ethyl (1S,14R,15Z)-15-ethylidene-5-methoxy-3,17-dimethyl-3-aza-17-azoniapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4(9),5,7-tetraene-13-carboxylate |
|---|---|
| PubChem CID | 102357237 |
| Molecular Formula | C24H31N2O3+ |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | ethyl (1S,14R,15Z)-15-ethylidene-5-methoxy-3,17-dimethyl-3-aza-17-azoniapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4(9),5,7-tetraene-13-carboxylate |
| SMILES | C/C=C1\C[N+]2(C)C3Cc4c(n(C)c5c(OC)cccc45)[C@@H]2C[C@@H]1C3C(=O)OCC |
| InChI | InChI=1S/C24H31N2O3/c1-6-14-13-26(4)18-12-17-15-9-8-10-20(28-5)23(15)25(3)22(17)19(26)11-16(14)21(18)24(27)29-7-2/h6,8-10,16,18-19,21H,7,11-13H2,1-5H3/q+1/b14-6+/t16-,18?,19-,21?,26?/m0/s1 |
| InChIKey | QYLOWVPDEGEWFW-DAXJUTDDSA-N |
| XLogP | 3.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|