C27H29FN4O3 — CID 11627056
N-[3-fluoro-4-(3-methoxypiperidin-1-yl)phenyl]-4-(5-methyl-2-pyridinyl)-2,3-dihydro-1,4-benzoxazine-8-carboxamide (PubChem CID 11627056) has the molecular formula C27H29FN4O3 and a molecular weight of 476.55 g/mol. Its IUPAC name is N-[3-fluoro-4-(3-methoxypiperidin-1-yl)phenyl]-4-(5-methyl-2-pyridinyl)-2,3-dihydro-1,4-benzoxazine-8-carboxamide.
| Compound Name | N-[3-fluoro-4-(3-methoxypiperidin-1-yl)phenyl]-4-(5-methyl-2-pyridinyl)-2,3-dihydro-1,4-benzoxazine-8-carboxamide |
|---|---|
| PubChem CID | 11627056 |
| Molecular Formula | C27H29FN4O3 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | N-[3-fluoro-4-(3-methoxypiperidin-1-yl)phenyl]-4-(5-methyl-2-pyridinyl)-2,3-dihydro-1,4-benzoxazine-8-carboxamide |
| SMILES | COC1CCCN(c2ccc(NC(=O)c3cccc4c3OCCN4c3ccc(C)cn3)cc2F)C1 |
| InChI | InChI=1S/C27H29FN4O3/c1-18-8-11-25(29-16-18)32-13-14-35-26-21(6-3-7-24(26)32)27(33)30-19-9-10-23(22(28)15-19)31-12-4-5-20(17-31)34-2/h3,6-11,15-16,20H,4-5,12-14,17H2,1-2H3,(H,30,33) |
| InChIKey | DMCCWAPQKQSCMN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|