C26H29FN4O4 — CID 143166416
N-(3-fluoro-4-morpholin-4-ylphenyl)-4-(5-methyl-2-pyridinyl)-2,3-dihydro-1,4-benzoxazine-8-carboxamide;methanol (PubChem CID 143166416) has the molecular formula C26H29FN4O4 and a molecular weight of 480.54 g/mol. Its IUPAC name is N-(3-fluoro-4-morpholin-4-ylphenyl)-4-(5-methyl-2-pyridinyl)-2,3-dihydro-1,4-benzoxazine-8-carboxamide;methanol.
| Compound Name | N-(3-fluoro-4-morpholin-4-ylphenyl)-4-(5-methyl-2-pyridinyl)-2,3-dihydro-1,4-benzoxazine-8-carboxamide;methanol |
|---|---|
| PubChem CID | 143166416 |
| Molecular Formula | C26H29FN4O4 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | N-(3-fluoro-4-morpholin-4-ylphenyl)-4-(5-methyl-2-pyridinyl)-2,3-dihydro-1,4-benzoxazine-8-carboxamide;methanol |
| SMILES | CO.Cc1ccc(N2CCOc3c(C(=O)Nc4ccc(N5CCOCC5)c(F)c4)cccc32)nc1 |
| InChI | InChI=1S/C25H25FN4O3.CH4O/c1-17-5-8-23(27-16-17)30-11-14-33-24-19(3-2-4-22(24)30)25(31)28-18-6-7-21(20(26)15-18)29-9-12-32-13-10-29;1-2/h2-8,15-16H,9-14H2,1H3,(H,28,31);2H,1H3 |
| InChIKey | HWRSXIIZSLAPBP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|