C22H19N3OS — CID 1162727
3-benzylsulfanyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazole (PubChem CID 1162727) has the molecular formula C22H19N3OS and a molecular weight of 373.48 g/mol. Its IUPAC name is 3-benzylsulfanyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazole.
| Compound Name | 3-benzylsulfanyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 1162727 |
| Molecular Formula | C22H19N3OS |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 3-benzylsulfanyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazole |
| SMILES | c1ccc(CSc2nnc(COc3ccccc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19N3OS/c1-4-10-18(11-5-1)17-27-22-24-23-21(16-26-20-14-8-3-9-15-20)25(22)19-12-6-2-7-13-19/h1-15H,16-17H2 |
| InChIKey | SSZGXGUFAAHHAF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |