C8H8O2 — CID 11629615
6,7-dihydro-4H-cyclopenta[b]pyran-5-one (PubChem CID 11629615) has the molecular formula C8H8O2 and a molecular weight of 136.15 g/mol. Its IUPAC name is 6,7-dihydro-4H-cyclopenta[b]pyran-5-one.
| Compound Name | 6,7-dihydro-4H-cyclopenta[b]pyran-5-one |
|---|---|
| PubChem CID | 11629615 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | 6,7-dihydro-4H-cyclopenta[b]pyran-5-one |
| SMILES | O=C1CCC2=C1CC=CO2 |
| InChI | InChI=1S/C8H8O2/c9-7-3-4-8-6(7)2-1-5-10-8/h1,5H,2-4H2 |
| InChIKey | GAEDHKGJWMLISN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |