C21H29NO4 — CID 11631842
3-(4-butoxy-3-cyclopentyloxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene (PubChem CID 11631842) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is 3-(4-butoxy-3-cyclopentyloxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene.
| Compound Name | 3-(4-butoxy-3-cyclopentyloxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene |
|---|---|
| PubChem CID | 11631842 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 3-(4-butoxy-3-cyclopentyloxyphenyl)-1,7-dioxa-2-azaspiro[4.4]non-2-ene |
| SMILES | CCCCOc1ccc(C2=NOC3(CCOC3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C21H29NO4/c1-2-3-11-24-19-9-8-16(13-20(19)25-17-6-4-5-7-17)18-14-21(26-22-18)10-12-23-15-21/h8-9,13,17H,2-7,10-12,14-15H2,1H3 |
| InChIKey | UOQVNBUESSOEMJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|