C20H36N2O4 — CID 11632069
tert-butyl 4-[2-(4-hydroxy-3-propylpiperidin-1-yl)-2-oxoethyl]piperidine-1-carboxylate (PubChem CID 11632069) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-hydroxy-3-propylpiperidin-1-yl)-2-oxoethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-hydroxy-3-propylpiperidin-1-yl)-2-oxoethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11632069 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | tert-butyl 4-[2-(4-hydroxy-3-propylpiperidin-1-yl)-2-oxoethyl]piperidine-1-carboxylate |
| SMILES | CCCC1CN(C(=O)CC2CCN(C(=O)OC(C)(C)C)CC2)CCC1O |
| InChI | InChI=1S/C20H36N2O4/c1-5-6-16-14-22(12-9-17(16)23)18(24)13-15-7-10-21(11-8-15)19(25)26-20(2,3)4/h15-17,23H,5-14H2,1-4H3 |
| InChIKey | SKCYTQGTCGAQEW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |