C21H38N2O4 — CID 11523801
tert-butyl 4-[2-(2-butyl-4-hydroxypiperidin-1-yl)-2-oxoethyl]piperidine-1-carboxylate (PubChem CID 11523801) has the molecular formula C21H38N2O4 and a molecular weight of 382.55 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-butyl-4-hydroxypiperidin-1-yl)-2-oxoethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-butyl-4-hydroxypiperidin-1-yl)-2-oxoethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11523801 |
| Molecular Formula | C21H38N2O4 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | tert-butyl 4-[2-(2-butyl-4-hydroxypiperidin-1-yl)-2-oxoethyl]piperidine-1-carboxylate |
| SMILES | CCCCC1CC(O)CCN1C(=O)CC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H38N2O4/c1-5-6-7-17-15-18(24)10-13-23(17)19(25)14-16-8-11-22(12-9-16)20(26)27-21(2,3)4/h16-18,24H,5-15H2,1-4H3 |
| InChIKey | KAIDJKSOWSARJK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |