C19H34N2O4 — CID 11660374
tert-butyl 4-[2-(2-ethyl-4-hydroxypiperidin-1-yl)-2-oxoethyl]piperidine-1-carboxylate (PubChem CID 11660374) has the molecular formula C19H34N2O4 and a molecular weight of 354.49 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-ethyl-4-hydroxypiperidin-1-yl)-2-oxoethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-ethyl-4-hydroxypiperidin-1-yl)-2-oxoethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11660374 |
| Molecular Formula | C19H34N2O4 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | tert-butyl 4-[2-(2-ethyl-4-hydroxypiperidin-1-yl)-2-oxoethyl]piperidine-1-carboxylate |
| SMILES | CCC1CC(O)CCN1C(=O)CC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H34N2O4/c1-5-15-13-16(22)8-11-21(15)17(23)12-14-6-9-20(10-7-14)18(24)25-19(2,3)4/h14-16,22H,5-13H2,1-4H3 |
| InChIKey | ZLBCBJWUZNLKIK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |