C21H26N2O3S — CID 11632445
1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine (PubChem CID 11632445) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine.
| Compound Name | 1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine |
|---|---|
| PubChem CID | 11632445 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine |
| SMILES | CC1(C)CC(N2CCNCC2)c2ccc(S(=O)(=O)c3ccccc3)cc2O1 |
| InChI | InChI=1S/C21H26N2O3S/c1-21(2)15-19(23-12-10-22-11-13-23)18-9-8-17(14-20(18)26-21)27(24,25)16-6-4-3-5-7-16/h3-9,14,19,22H,10-13,15H2,1-2H3 |
| InChIKey | ZEYGWJWYFCBOEU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |