About 1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine
1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine (PubChem CID 11632445) has the molecular formula C21H26N2O3S
and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine.
Molecular Properties
| Compound Name | 1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine |
| PubChem CID | 11632445 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine |
| SMILES | CC1(C)CC(N2CCNCC2)c2ccc(S(=O)(=O)c3ccccc3)cc2O1 |
| InChI | InChI=1S/C21H26N2O3S/c1-21(2)15-19(23-12-10-22-11-13-23)18-9-8-17(14-20(18)26-21)27(24,25)16-6-4-3-5-7-16/h3-9,14,19,22H,10-13,15H2,1-2H3 |
| InChIKey | ZEYGWJWYFCBOEU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine?
The IUPAC name of 1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine (CID 11632445) is 1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine.
What is the SMILES notation for 1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine?
The canonical SMILES for 1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine is CC1(C)CC(N2CCNCC2)c2ccc(S(=O)(=O)c3ccccc3)cc2O1.
What is the InChIKey of 1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine?
The InChIKey is ZEYGWJWYFCBOEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O3S/c1-21(2)15-19(23-12-10-22-11-13-23)18-9-8-17(14-20(18)26-21)27(24,25)16-6-4-3-5-7-16/h3-9,14,19,22H,10-13,15H2,1-2H3.
What are the key properties of 1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine?
1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine has a molecular weight of 386.52 g/mol, XLogP of 3.03, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[7-(benzenesulfonyl)-2,2-dimethyl-3,4-dihydrochromen-4-yl]piperazine is sourced from PubChem (CID 11632445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).