C18H13N7O2S — CID 11632532
4-(4-azido-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)benzenesulfonamide (PubChem CID 11632532) has the molecular formula C18H13N7O2S and a molecular weight of 391.42 g/mol. Its IUPAC name is 4-(4-azido-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)benzenesulfonamide.
| Compound Name | 4-(4-azido-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 11632532 |
| Molecular Formula | C18H13N7O2S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 4-(4-azido-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl)benzenesulfonamide |
| SMILES | [N-]=[N+]=Nc1ncnc2c1c(-c1ccccc1)cn2-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H13N7O2S/c19-24-23-17-16-15(12-4-2-1-3-5-12)10-25(18(16)22-11-21-17)13-6-8-14(9-7-13)28(20,26)27/h1-11H,(H2,20,26,27) |
| InChIKey | FPFGKNVROGJJLI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 139.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|