C27H36O2 — CID 11632573
[2-ethenyl-2,4-diethyl-4-(phenylmethoxymethyl)hex-5-enoxy]methylbenzene (PubChem CID 11632573) has the molecular formula C27H36O2 and a molecular weight of 392.58 g/mol. Its IUPAC name is [2-ethenyl-2,4-diethyl-4-(phenylmethoxymethyl)hex-5-enoxy]methylbenzene.
| Compound Name | [2-ethenyl-2,4-diethyl-4-(phenylmethoxymethyl)hex-5-enoxy]methylbenzene |
|---|---|
| PubChem CID | 11632573 |
| Molecular Formula | C27H36O2 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | [2-ethenyl-2,4-diethyl-4-(phenylmethoxymethyl)hex-5-enoxy]methylbenzene |
| SMILES | C=CC(CC)(COCc1ccccc1)CC(C=C)(CC)COCc1ccccc1 |
| InChI | InChI=1S/C27H36O2/c1-5-26(6-2,22-28-19-24-15-11-9-12-16-24)21-27(7-3,8-4)23-29-20-25-17-13-10-14-18-25/h5,7,9-18H,1,3,6,8,19-23H2,2,4H3 |
| InChIKey | BAYHPFWRKJOQQD-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|