C22H26N2O5S — CID 11633370
formic acid;4-hydroxy-7-[(1R)-1-hydroxy-2-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]ethyl]-3H-1,3-benzothiazol-2-one (PubChem CID 11633370) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is formic acid;4-hydroxy-7-[(1R)-1-hydroxy-2-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]ethyl]-3H-1,3-benzothiazol-2-one.
| Compound Name | formic acid;4-hydroxy-7-[(1R)-1-hydroxy-2-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]ethyl]-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 11633370 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | formic acid;4-hydroxy-7-[(1R)-1-hydroxy-2-[2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylamino]ethyl]-3H-1,3-benzothiazol-2-one |
| SMILES | O=CO.O=c1[nH]c2c(O)ccc([C@@H](O)CNCCc3ccc4c(c3)CCCC4)c2s1 |
| InChI | InChI=1S/C21H24N2O3S.CH2O2/c24-17-8-7-16(20-19(17)23-21(26)27-20)18(25)12-22-10-9-13-5-6-14-3-1-2-4-15(14)11-13;2-1-3/h5-8,11,18,22,24-25H,1-4,9-10,12H2,(H,23,26);1H,(H,2,3)/t18-;/m0./s1 |
| InChIKey | ZEXCGJJNMGJWDF-FERBBOLQSA-N |
| XLogP | 2.74 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|