C32H33N3O3S — CID 67166865
7-[2-[2-[3-[(2,2-diphenylethylamino)methyl]phenyl]ethylamino]-1-hydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one (PubChem CID 67166865) has the molecular formula C32H33N3O3S and a molecular weight of 539.70 g/mol. Its IUPAC name is 7-[2-[2-[3-[(2,2-diphenylethylamino)methyl]phenyl]ethylamino]-1-hydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one.
| Compound Name | 7-[2-[2-[3-[(2,2-diphenylethylamino)methyl]phenyl]ethylamino]-1-hydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 67166865 |
| Molecular Formula | C32H33N3O3S |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 7-[2-[2-[3-[(2,2-diphenylethylamino)methyl]phenyl]ethylamino]-1-hydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2c(O)ccc(C(O)CNCCc3cccc(CNCC(c4ccccc4)c4ccccc4)c3)c2s1 |
| InChI | InChI=1S/C32H33N3O3S/c36-28-15-14-26(31-30(28)35-32(38)39-31)29(37)21-33-17-16-22-8-7-9-23(18-22)19-34-20-27(24-10-3-1-4-11-24)25-12-5-2-6-13-25/h1-15,18,27,29,33-34,36-37H,16-17,19-21H2,(H,35,38) |
| InChIKey | XLPXMNLCZGSYPS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|