C31H31N3O2S — CID 57393350
7-[2-[2-[3-[3-[(benzylamino)methyl]phenyl]phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one (PubChem CID 57393350) has the molecular formula C31H31N3O2S and a molecular weight of 509.68 g/mol. Its IUPAC name is 7-[2-[2-[3-[3-[(benzylamino)methyl]phenyl]phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one.
| Compound Name | 7-[2-[2-[3-[3-[(benzylamino)methyl]phenyl]phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 57393350 |
| Molecular Formula | C31H31N3O2S |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 7-[2-[2-[3-[3-[(benzylamino)methyl]phenyl]phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2c(O)ccc(CCNCCc3cccc(-c4cccc(CNCc5ccccc5)c4)c3)c2s1 |
| InChI | InChI=1S/C31H31N3O2S/c35-28-13-12-25(30-29(28)34-31(36)37-30)15-17-32-16-14-22-8-4-10-26(18-22)27-11-5-9-24(19-27)21-33-20-23-6-2-1-3-7-23/h1-13,18-19,32-33,35H,14-17,20-21H2,(H,34,36) |
| InChIKey | UGGHXKYYWLVRAE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|