C22H27FN4O3S — CID 67175498
3-[2-(3-fluorophenyl)ethylamino]-N-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]propanamide (PubChem CID 67175498) has the molecular formula C22H27FN4O3S and a molecular weight of 446.55 g/mol. Its IUPAC name is 3-[2-(3-fluorophenyl)ethylamino]-N-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]propanamide.
| Compound Name | 3-[2-(3-fluorophenyl)ethylamino]-N-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 67175498 |
| Molecular Formula | C22H27FN4O3S |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 3-[2-(3-fluorophenyl)ethylamino]-N-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]propanamide |
| SMILES | O=C(CCNCCc1cccc(F)c1)NCCNCCc1ccc(O)c2[nH]c(=O)sc12 |
| InChI | InChI=1S/C22H27FN4O3S/c23-17-3-1-2-15(14-17)6-9-24-11-8-19(29)26-13-12-25-10-7-16-4-5-18(28)20-21(16)31-22(30)27-20/h1-5,14,24-25,28H,6-13H2,(H,26,29)(H,27,30) |
| InChIKey | RBWGTKKNOCJAIZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|