C31H39F7N4O7S — CID 87439954
N-(2,2-dimethylpropyl)-3-[2-(3-fluorophenyl)ethyl-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]amino]propanamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87439954) has the molecular formula C31H39F7N4O7S and a molecular weight of 744.73 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-3-[2-(3-fluorophenyl)ethyl-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]amino]propanamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-(2,2-dimethylpropyl)-3-[2-(3-fluorophenyl)ethyl-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]amino]propanamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87439954 |
| Molecular Formula | C31H39F7N4O7S |
| Molecular Weight | 744.73 g/mol |
| Exact Mass | 744.24 |
| IUPAC Name | N-(2,2-dimethylpropyl)-3-[2-(3-fluorophenyl)ethyl-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]amino]propanamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC(C)(C)CNC(=O)CCN(CCNCCc1ccc(O)c2[nH]c(=O)sc12)CCc1cccc(F)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H37FN4O3S.2C2HF3O2/c1-27(2,3)18-30-23(34)11-15-32(14-10-19-5-4-6-21(28)17-19)16-13-29-12-9-20-7-8-22(33)24-25(20)36-26(35)31-24;2*3-2(4,5)1(6)7/h4-8,17,29,33H,9-16,18H2,1-3H3,(H,30,34)(H,31,35);2*(H,6,7) |
| InChIKey | VGSIITLVRSKGSC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.73 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|