C26H31Cl2N3O5S — CID 69191686
7-[1,1-dihydroxy-2-[2-[3-[[2-(2-hydroxyphenyl)ethylamino]methyl]phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one;dihydrochloride (PubChem CID 69191686) has the molecular formula C26H31Cl2N3O5S and a molecular weight of 568.52 g/mol. Its IUPAC name is 7-[1,1-dihydroxy-2-[2-[3-[[2-(2-hydroxyphenyl)ethylamino]methyl]phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one;dihydrochloride.
| Compound Name | 7-[1,1-dihydroxy-2-[2-[3-[[2-(2-hydroxyphenyl)ethylamino]methyl]phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one;dihydrochloride |
|---|---|
| PubChem CID | 69191686 |
| Molecular Formula | C26H31Cl2N3O5S |
| Molecular Weight | 568.52 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | 7-[1,1-dihydroxy-2-[2-[3-[[2-(2-hydroxyphenyl)ethylamino]methyl]phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one;dihydrochloride |
| SMILES | Cl.Cl.O=c1[nH]c2c(O)ccc(C(O)(O)CNCCc3cccc(CNCCc4ccccc4O)c3)c2s1 |
| InChI | InChI=1S/C26H29N3O5S.2ClH/c30-21-7-2-1-6-19(21)11-13-27-15-18-5-3-4-17(14-18)10-12-28-16-26(33,34)20-8-9-22(31)23-24(20)35-25(32)29-23;;/h1-9,14,27-28,30-31,33-34H,10-13,15-16H2,(H,29,32);2*1H |
| InChIKey | KDZYMICSDASQEJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|