C23H29N3O4S — CID 69177678
7-[1,1-dihydroxy-2-[2-[3-(piperidin-1-ylmethyl)phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one (PubChem CID 69177678) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is 7-[1,1-dihydroxy-2-[2-[3-(piperidin-1-ylmethyl)phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one.
| Compound Name | 7-[1,1-dihydroxy-2-[2-[3-(piperidin-1-ylmethyl)phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 69177678 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 7-[1,1-dihydroxy-2-[2-[3-(piperidin-1-ylmethyl)phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2c(O)ccc(C(O)(O)CNCCc3cccc(CN4CCCCC4)c3)c2s1 |
| InChI | InChI=1S/C23H29N3O4S/c27-19-8-7-18(21-20(19)25-22(28)31-21)23(29,30)15-24-10-9-16-5-4-6-17(13-16)14-26-11-2-1-3-12-26/h4-8,13,24,27,29-30H,1-3,9-12,14-15H2,(H,25,28) |
| InChIKey | HCBRHRCULLTASJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|