C22H28N4O3S — CID 67165335
4-hydroxy-7-[2-hydroxy-2-[2-[3-(piperazin-1-ylmethyl)phenyl]ethylamino]ethyl]-3H-1,3-benzothiazol-2-one (PubChem CID 67165335) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is 4-hydroxy-7-[2-hydroxy-2-[2-[3-(piperazin-1-ylmethyl)phenyl]ethylamino]ethyl]-3H-1,3-benzothiazol-2-one.
| Compound Name | 4-hydroxy-7-[2-hydroxy-2-[2-[3-(piperazin-1-ylmethyl)phenyl]ethylamino]ethyl]-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 67165335 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 4-hydroxy-7-[2-hydroxy-2-[2-[3-(piperazin-1-ylmethyl)phenyl]ethylamino]ethyl]-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2c(O)ccc(CC(O)NCCc3cccc(CN4CCNCC4)c3)c2s1 |
| InChI | InChI=1S/C22H28N4O3S/c27-18-5-4-17(21-20(18)25-22(29)30-21)13-19(28)24-7-6-15-2-1-3-16(12-15)14-26-10-8-23-9-11-26/h1-5,12,19,23-24,27-28H,6-11,13-14H2,(H,25,29) |
| InChIKey | CACCFLWMXHFOSV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|