C22H28N4O4S — CID 69178957
7-[2,2-dihydroxy-2-[2-[3-(piperazin-1-ylmethyl)phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one (PubChem CID 69178957) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is 7-[2,2-dihydroxy-2-[2-[3-(piperazin-1-ylmethyl)phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one.
| Compound Name | 7-[2,2-dihydroxy-2-[2-[3-(piperazin-1-ylmethyl)phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 69178957 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 7-[2,2-dihydroxy-2-[2-[3-(piperazin-1-ylmethyl)phenyl]ethylamino]ethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2c(O)ccc(CC(O)(O)NCCc3cccc(CN4CCNCC4)c3)c2s1 |
| InChI | InChI=1S/C22H28N4O4S/c27-18-5-4-17(20-19(18)25-21(28)31-20)13-22(29,30)24-7-6-15-2-1-3-16(12-15)14-26-10-8-23-9-11-26/h1-5,12,23-24,27,29-30H,6-11,13-14H2,(H,25,28) |
| InChIKey | FLMLQGOEVBHXQA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|