C32H33N3O4S — CID 69159080
7-[2-[2-[4-[(2,2-diphenylethylamino)methyl]phenyl]ethylamino]-1,1-dihydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one (PubChem CID 69159080) has the molecular formula C32H33N3O4S and a molecular weight of 555.70 g/mol. Its IUPAC name is 7-[2-[2-[4-[(2,2-diphenylethylamino)methyl]phenyl]ethylamino]-1,1-dihydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one.
| Compound Name | 7-[2-[2-[4-[(2,2-diphenylethylamino)methyl]phenyl]ethylamino]-1,1-dihydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 69159080 |
| Molecular Formula | C32H33N3O4S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 7-[2-[2-[4-[(2,2-diphenylethylamino)methyl]phenyl]ethylamino]-1,1-dihydroxyethyl]-4-hydroxy-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2c(O)ccc(C(O)(O)CNCCc3ccc(CNCC(c4ccccc4)c4ccccc4)cc3)c2s1 |
| InChI | InChI=1S/C32H33N3O4S/c36-28-16-15-27(30-29(28)35-31(37)40-30)32(38,39)21-33-18-17-22-11-13-23(14-12-22)19-34-20-26(24-7-3-1-4-8-24)25-9-5-2-6-10-25/h1-16,26,33-34,36,38-39H,17-21H2,(H,35,37) |
| InChIKey | OLPGULIFEPWPRH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|