C22H27N3O5S — CID 69189849
N-(2,2-dimethoxyethyl)-4-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]benzamide (PubChem CID 69189849) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-4-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]benzamide.
| Compound Name | N-(2,2-dimethoxyethyl)-4-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 69189849 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-4-[2-[2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]ethyl]benzamide |
| SMILES | COC(CNC(=O)c1ccc(CCNCCc2ccc(O)c3[nH]c(=O)sc23)cc1)OC |
| InChI | InChI=1S/C22H27N3O5S/c1-29-18(30-2)13-24-21(27)16-5-3-14(4-6-16)9-11-23-12-10-15-7-8-17(26)19-20(15)31-22(28)25-19/h3-8,18,23,26H,9-13H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | BRWWCRBLXGEBSL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|