C23H30N2O4S — CID 19082237
4-hydroxy-7-[2-[6-[2-(4-hydroxyphenyl)ethoxy]hexylamino]ethyl]-3H-1,3-benzothiazol-2-one (PubChem CID 19082237) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is 4-hydroxy-7-[2-[6-[2-(4-hydroxyphenyl)ethoxy]hexylamino]ethyl]-3H-1,3-benzothiazol-2-one.
| Compound Name | 4-hydroxy-7-[2-[6-[2-(4-hydroxyphenyl)ethoxy]hexylamino]ethyl]-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 19082237 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 4-hydroxy-7-[2-[6-[2-(4-hydroxyphenyl)ethoxy]hexylamino]ethyl]-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2c(O)ccc(CCNCCCCCCOCCc3ccc(O)cc3)c2s1 |
| InChI | InChI=1S/C23H30N2O4S/c26-19-8-5-17(6-9-19)12-16-29-15-4-2-1-3-13-24-14-11-18-7-10-20(27)21-22(18)30-23(28)25-21/h5-10,24,26-27H,1-4,11-16H2,(H,25,28) |
| InChIKey | SIQJSRQQENMHOG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|