C22H29ClN2O3S — CID 70204464
4-hydroxy-7-[2-[5-(2-phenylethoxy)pentylamino]ethyl]-3H-1,3-benzothiazol-2-one;hydrochloride (PubChem CID 70204464) has the molecular formula C22H29ClN2O3S and a molecular weight of 437.01 g/mol. Its IUPAC name is 4-hydroxy-7-[2-[5-(2-phenylethoxy)pentylamino]ethyl]-3H-1,3-benzothiazol-2-one;hydrochloride.
| Compound Name | 4-hydroxy-7-[2-[5-(2-phenylethoxy)pentylamino]ethyl]-3H-1,3-benzothiazol-2-one;hydrochloride |
|---|---|
| PubChem CID | 70204464 |
| Molecular Formula | C22H29ClN2O3S |
| Molecular Weight | 437.01 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 4-hydroxy-7-[2-[5-(2-phenylethoxy)pentylamino]ethyl]-3H-1,3-benzothiazol-2-one;hydrochloride |
| SMILES | Cl.O=c1[nH]c2c(O)ccc(CCNCCCCCOCCc3ccccc3)c2s1 |
| InChI | InChI=1S/C22H28N2O3S.ClH/c25-19-10-9-18(21-20(19)24-22(26)28-21)11-14-23-13-5-2-6-15-27-16-12-17-7-3-1-4-8-17;/h1,3-4,7-10,23,25H,2,5-6,11-16H2,(H,24,26);1H |
| InChIKey | QPAVTRANACZMTF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.01 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|