C21H24N2O6S — CID 143698448
2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethyl N-benzyl-N-(2,2-dimethoxyethyl)carbamate (PubChem CID 143698448) has the molecular formula C21H24N2O6S and a molecular weight of 432.50 g/mol. Its IUPAC name is 2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethyl N-benzyl-N-(2,2-dimethoxyethyl)carbamate.
| Compound Name | 2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethyl N-benzyl-N-(2,2-dimethoxyethyl)carbamate |
|---|---|
| PubChem CID | 143698448 |
| Molecular Formula | C21H24N2O6S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethyl N-benzyl-N-(2,2-dimethoxyethyl)carbamate |
| SMILES | COC(CN(Cc1ccccc1)C(=O)OCCc1ccc(O)c2[nH]c(=O)sc12)OC |
| InChI | InChI=1S/C21H24N2O6S/c1-27-17(28-2)13-23(12-14-6-4-3-5-7-14)21(26)29-11-10-15-8-9-16(24)18-19(15)30-20(25)22-18/h3-9,17,24H,10-13H2,1-2H3,(H,22,25) |
| InChIKey | NNGCYDQSTOBVBM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|