C21H22ClNO4S2 — CID 11633832
S-[2-[3-[(6-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)methylsulfamoyl]phenyl]-2-oxoethyl] ethanethioate (PubChem CID 11633832) has the molecular formula C21H22ClNO4S2 and a molecular weight of 452.00 g/mol. Its IUPAC name is S-[2-[3-[(6-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)methylsulfamoyl]phenyl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[3-[(6-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)methylsulfamoyl]phenyl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 11633832 |
| Molecular Formula | C21H22ClNO4S2 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | S-[2-[3-[(6-chloro-5,6,7,8-tetrahydronaphthalen-2-yl)methylsulfamoyl]phenyl]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1cccc(S(=O)(=O)NCc2ccc3c(c2)CCC(Cl)C3)c1 |
| InChI | InChI=1S/C21H22ClNO4S2/c1-14(24)28-13-21(25)18-3-2-4-20(11-18)29(26,27)23-12-15-5-6-17-10-19(22)8-7-16(17)9-15/h2-6,9,11,19,23H,7-8,10,12-13H2,1H3 |
| InChIKey | XDSBMKUZVFSNGS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|