C15H20 — CID 11637023
1-(1,3-dimethylcyclohex-2-en-1-yl)-4-methylbenzene (PubChem CID 11637023) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 1-(1,3-dimethylcyclohex-2-en-1-yl)-4-methylbenzene.
| Compound Name | 1-(1,3-dimethylcyclohex-2-en-1-yl)-4-methylbenzene |
|---|---|
| PubChem CID | 11637023 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 1-(1,3-dimethylcyclohex-2-en-1-yl)-4-methylbenzene |
| SMILES | CC1=CC(C)(c2ccc(C)cc2)CCC1 |
| InChI | InChI=1S/C15H20/c1-12-6-8-14(9-7-12)15(3)10-4-5-13(2)11-15/h6-9,11H,4-5,10H2,1-3H3 |
| InChIKey | PXSPBJRQKOJOTF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|