C16H16N2O7 — CID 11638821
4-(carboxymethylamino)-3-ethoxycarbonyl-5-oxo-1-phenyl-2H-pyrrole-2-carboxylic acid (PubChem CID 11638821) has the molecular formula C16H16N2O7 and a molecular weight of 348.31 g/mol. Its IUPAC name is 4-(carboxymethylamino)-3-ethoxycarbonyl-5-oxo-1-phenyl-2H-pyrrole-2-carboxylic acid.
| Compound Name | 4-(carboxymethylamino)-3-ethoxycarbonyl-5-oxo-1-phenyl-2H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 11638821 |
| Molecular Formula | C16H16N2O7 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 4-(carboxymethylamino)-3-ethoxycarbonyl-5-oxo-1-phenyl-2H-pyrrole-2-carboxylic acid |
| SMILES | CCOC(=O)C1=C(NCC(=O)O)C(=O)N(c2ccccc2)C1C(=O)O |
| InChI | InChI=1S/C16H16N2O7/c1-2-25-16(24)11-12(17-8-10(19)20)14(21)18(13(11)15(22)23)9-6-4-3-5-7-9/h3-7,13,17H,2,8H2,1H3,(H,19,20)(H,22,23) |
| InChIKey | BIOQHTJTRQZPPF-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |