C25H39N3O5 — CID 11641199
(3S)-3-(2-methylpropyl)-1-propyl-9-[(2,4,6-trimethoxyphenyl)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione (PubChem CID 11641199) has the molecular formula C25H39N3O5 and a molecular weight of 461.60 g/mol. Its IUPAC name is (3S)-3-(2-methylpropyl)-1-propyl-9-[(2,4,6-trimethoxyphenyl)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione.
| Compound Name | (3S)-3-(2-methylpropyl)-1-propyl-9-[(2,4,6-trimethoxyphenyl)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 11641199 |
| Molecular Formula | C25H39N3O5 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | (3S)-3-(2-methylpropyl)-1-propyl-9-[(2,4,6-trimethoxyphenyl)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
| SMILES | CCCN1C(=O)[C@H](CC(C)C)NC(=O)C12CCN(Cc1c(OC)cc(OC)cc1OC)CC2 |
| InChI | InChI=1S/C25H39N3O5/c1-7-10-28-23(29)20(13-17(2)3)26-24(30)25(28)8-11-27(12-9-25)16-19-21(32-5)14-18(31-4)15-22(19)33-6/h14-15,17,20H,7-13,16H2,1-6H3,(H,26,30)/t20-/m0/s1 |
| InChIKey | WTWFCVAIBCODDT-FQEVSTJZSA-N |
| XLogP | 2.83 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |