C27H41N3O5 — CID 23109342
3-(cyclohexylmethyl)-1-propyl-8-[(2,4,6-trimethoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 23109342) has the molecular formula C27H41N3O5 and a molecular weight of 487.64 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-1-propyl-8-[(2,4,6-trimethoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(cyclohexylmethyl)-1-propyl-8-[(2,4,6-trimethoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 23109342 |
| Molecular Formula | C27H41N3O5 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.30 |
| IUPAC Name | 3-(cyclohexylmethyl)-1-propyl-8-[(2,4,6-trimethoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCCN1C(=O)N(CC2CCCCC2)C(=O)C12CCN(Cc1c(OC)cc(OC)cc1OC)CC2 |
| InChI | InChI=1S/C27H41N3O5/c1-5-13-30-26(32)29(18-20-9-7-6-8-10-20)25(31)27(30)11-14-28(15-12-27)19-22-23(34-3)16-21(33-2)17-24(22)35-4/h16-17,20H,5-15,18-19H2,1-4H3 |
| InChIKey | ATPGFWSEBNQLLO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|