C25H35N3O4 — CID 23109436
8-(1,3-benzodioxol-4-ylmethyl)-3-(cyclohexylmethyl)-1-propyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 23109436) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is 8-(1,3-benzodioxol-4-ylmethyl)-3-(cyclohexylmethyl)-1-propyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(1,3-benzodioxol-4-ylmethyl)-3-(cyclohexylmethyl)-1-propyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 23109436 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 8-(1,3-benzodioxol-4-ylmethyl)-3-(cyclohexylmethyl)-1-propyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCCN1C(=O)N(CC2CCCCC2)C(=O)C12CCN(Cc1cccc3c1OCO3)CC2 |
| InChI | InChI=1S/C25H35N3O4/c1-2-13-28-24(30)27(16-19-7-4-3-5-8-19)23(29)25(28)11-14-26(15-12-25)17-20-9-6-10-21-22(20)32-18-31-21/h6,9-10,19H,2-5,7-8,11-18H2,1H3 |
| InChIKey | AZTTVBCKQJICLQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|