C26H39N3O2 — CID 23109454
3-(cyclohexylmethyl)-8-(3-phenylpropyl)-1-propyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 23109454) has the molecular formula C26H39N3O2 and a molecular weight of 425.62 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-8-(3-phenylpropyl)-1-propyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(cyclohexylmethyl)-8-(3-phenylpropyl)-1-propyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 23109454 |
| Molecular Formula | C26H39N3O2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | 3-(cyclohexylmethyl)-8-(3-phenylpropyl)-1-propyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCCN1C(=O)N(CC2CCCCC2)C(=O)C12CCN(CCCc1ccccc1)CC2 |
| InChI | InChI=1S/C26H39N3O2/c1-2-17-29-25(31)28(21-23-12-7-4-8-13-23)24(30)26(29)15-19-27(20-16-26)18-9-14-22-10-5-3-6-11-22/h3,5-6,10-11,23H,2,4,7-9,12-21H2,1H3 |
| InChIKey | ZNJGZSBOMWEDER-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|