C33H45N3O3 — CID 10392263
(8aS)-1'-(6-phenylhexyl)-7-phenylmethoxy-2-propylspiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-3,4'-piperidine]-1,4-dione (PubChem CID 10392263) has the molecular formula C33H45N3O3 and a molecular weight of 531.74 g/mol. Its IUPAC name is (8aS)-1'-(6-phenylhexyl)-7-phenylmethoxy-2-propylspiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-3,4'-piperidine]-1,4-dione.
| Compound Name | (8aS)-1'-(6-phenylhexyl)-7-phenylmethoxy-2-propylspiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-3,4'-piperidine]-1,4-dione |
|---|---|
| PubChem CID | 10392263 |
| Molecular Formula | C33H45N3O3 |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.35 |
| IUPAC Name | (8aS)-1'-(6-phenylhexyl)-7-phenylmethoxy-2-propylspiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-3,4'-piperidine]-1,4-dione |
| SMILES | CCCN1C(=O)[C@@H]2CC(OCc3ccccc3)CN2C(=O)C12CCN(CCCCCCc1ccccc1)CC2 |
| InChI | InChI=1S/C33H45N3O3/c1-2-20-36-31(37)30-24-29(39-26-28-16-10-6-11-17-28)25-35(30)32(38)33(36)18-22-34(23-19-33)21-12-4-3-7-13-27-14-8-5-9-15-27/h5-6,8-11,14-17,29-30H,2-4,7,12-13,18-26H2,1H3/t29?,30-/m0/s1 |
| InChIKey | GNOCWOXFWPMPKJ-ZSXSBBPPSA-N |
| XLogP | 5.06 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|