C32H45ClN4O4 — CID 10121116
benzyl N-[4-[(3R)-2,5-dioxo-9-(3-phenylpropyl)-1-propyl-1,4,9-triazaspiro[5.5]undecan-3-yl]butyl]carbamate;hydrochloride (PubChem CID 10121116) has the molecular formula C32H45ClN4O4 and a molecular weight of 585.19 g/mol. Its IUPAC name is benzyl N-[4-[(3R)-2,5-dioxo-9-(3-phenylpropyl)-1-propyl-1,4,9-triazaspiro[5.5]undecan-3-yl]butyl]carbamate;hydrochloride.
| Compound Name | benzyl N-[4-[(3R)-2,5-dioxo-9-(3-phenylpropyl)-1-propyl-1,4,9-triazaspiro[5.5]undecan-3-yl]butyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 10121116 |
| Molecular Formula | C32H45ClN4O4 |
| Molecular Weight | 585.19 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | benzyl N-[4-[(3R)-2,5-dioxo-9-(3-phenylpropyl)-1-propyl-1,4,9-triazaspiro[5.5]undecan-3-yl]butyl]carbamate;hydrochloride |
| SMILES | CCCN1C(=O)[C@@H](CCCCNC(=O)OCc2ccccc2)NC(=O)C12CCN(CCCc1ccccc1)CC2.Cl |
| InChI | InChI=1S/C32H44N4O4.ClH/c1-2-21-36-29(37)28(17-9-10-20-33-31(39)40-25-27-14-7-4-8-15-27)34-30(38)32(36)18-23-35(24-19-32)22-11-16-26-12-5-3-6-13-26;/h3-8,12-15,28H,2,9-11,16-25H2,1H3,(H,33,39)(H,34,38);1H/t28-;/m1./s1 |
| InChIKey | FSEDFPNXLJLQAR-LNLSOMNWSA-N |
| XLogP | 4.71 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.19 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|